C9H11F2NO3 — CID 116991137
(E)-4-(4,4-difluoropiperidin-1-yl)-4-oxobut-2-enoic acid (PubChem CID 116991137) has the molecular formula C9H11F2NO3 and a molecular weight of 219.19 g/mol. Its IUPAC name is (E)-4-(4,4-difluoropiperidin-1-yl)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(4,4-difluoropiperidin-1-yl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 116991137 |
| Molecular Formula | C9H11F2NO3 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (E)-4-(4,4-difluoropiperidin-1-yl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H11F2NO3/c10-9(11)3-5-12(6-4-9)7(13)1-2-8(14)15/h1-2H,3-6H2,(H,14,15)/b2-1+ |
| InChIKey | MXDMEAQTLHLWQR-OWOJBTEDSA-N |
| XLogP | 0.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|