C8H13F3N2O2 — CID 119326792
2-amino-1-[3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 119326792) has the molecular formula C8H13F3N2O2 and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-amino-1-[3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 119326792 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-amino-1-[3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | NCC(=O)N1CCCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C8H13F3N2O2/c9-8(10,11)7(15)2-1-3-13(5-7)6(14)4-12/h15H,1-5,12H2 |
| InChIKey | JONAGLXVDQDSDT-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |