C12H13F3N2O2 — CID 71981899
[3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 71981899) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is [3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 71981899 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [3-hydroxy-3-(trifluoromethyl)piperidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1CCCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)11(19)4-1-7-17(8-11)10(18)9-2-5-16-6-3-9/h2-3,5-6,19H,1,4,7-8H2 |
| InChIKey | BRDRVQNUOXHOBF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |