C16H29NO3 — CID 65283776
4-(4,4-dimethylazepan-1-yl)-2,2-diethyl-4-oxobutanoic acid (PubChem CID 65283776) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-(4,4-dimethylazepan-1-yl)-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-(4,4-dimethylazepan-1-yl)-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 65283776 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-(4,4-dimethylazepan-1-yl)-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)N1CCCC(C)(C)CC1)C(=O)O |
| InChI | InChI=1S/C16H29NO3/c1-5-16(6-2,14(19)20)12-13(18)17-10-7-8-15(3,4)9-11-17/h5-12H2,1-4H3,(H,19,20) |
| InChIKey | XARFEPNJFRGWJA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |