C14H24N2O4 — CID 43437467
4-(4-carbamoylpiperidin-1-yl)-2,2-diethyl-4-oxobutanoic acid (PubChem CID 43437467) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(4-carbamoylpiperidin-1-yl)-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-(4-carbamoylpiperidin-1-yl)-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43437467 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-(4-carbamoylpiperidin-1-yl)-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)N1CCC(C(N)=O)CC1)C(=O)O |
| InChI | InChI=1S/C14H24N2O4/c1-3-14(4-2,13(19)20)9-11(17)16-7-5-10(6-8-16)12(15)18/h10H,3-9H2,1-2H3,(H2,15,18)(H,19,20) |
| InChIKey | DHCKUCRZYHAARK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |