C11H24ClN3O3S2 — CID 22732128
N-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]-N-methylmethanesulfonamide;hydrochloride (PubChem CID 22732128) has the molecular formula C11H24ClN3O3S2 and a molecular weight of 345.92 g/mol. Its IUPAC name is N-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]-N-methylmethanesulfonamide;hydrochloride.
| Compound Name | N-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]-N-methylmethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22732128 |
| Molecular Formula | C11H24ClN3O3S2 |
| Molecular Weight | 345.92 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]-N-methylmethanesulfonamide;hydrochloride |
| SMILES | CN(CCCCC(N)C(=O)N1CCSC1)S(C)(=O)=O.Cl |
| InChI | InChI=1S/C11H23N3O3S2.ClH/c1-13(19(2,16)17)6-4-3-5-10(12)11(15)14-7-8-18-9-14;/h10H,3-9,12H2,1-2H3;1H |
| InChIKey | NURRTABGXGMWCV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.92 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|