About 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide
6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 23014330) has the molecular formula C19H30N6O2S
and a molecular weight of 406.56 g/mol. Its IUPAC name is 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide |
| PubChem CID | 23014330 |
| Molecular Formula | C19H30N6O2S |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCN(CCCCC(N)C(=O)N3CCSC3)CC2)nc1 |
| InChI | InChI=1S/C19H30N6O2S/c20-16(19(27)25-11-12-28-14-25)3-1-2-6-23-7-9-24(10-8-23)17-5-4-15(13-22-17)18(21)26/h4-5,13,16H,1-3,6-12,14,20H2,(H2,21,26) |
| InChIKey | HDPOJBNNVMGXMX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 108.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide?
The IUPAC name of 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide (CID 23014330) is 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide.
What is the SMILES notation for 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide?
The canonical SMILES for 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide is NC(=O)c1ccc(N2CCN(CCCCC(N)C(=O)N3CCSC3)CC2)nc1.
What is the InChIKey of 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide?
The InChIKey is HDPOJBNNVMGXMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N6O2S/c20-16(19(27)25-11-12-28-14-25)3-1-2-6-23-7-9-24(10-8-23)17-5-4-15(13-22-17)18(21)26/h4-5,13,16H,1-3,6-12,14,20H2,(H2,21,26).
What are the key properties of 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide?
6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide has a molecular weight of 406.56 g/mol, XLogP of 0.33, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[5-amino-6-oxo-6-(1,3-thiazolidin-3-yl)hexyl]piperazin-1-yl]pyridine-3-carboxamide is sourced from PubChem (CID 23014330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).