C21H33N5O3S — CID 91178920
ethyl 6-[4-[5-amino-6-(4,5-dihydro-1,3-thiazol-2-yl)-6-hydroxyhexyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 91178920) has the molecular formula C21H33N5O3S and a molecular weight of 435.59 g/mol. Its IUPAC name is ethyl 6-[4-[5-amino-6-(4,5-dihydro-1,3-thiazol-2-yl)-6-hydroxyhexyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-[5-amino-6-(4,5-dihydro-1,3-thiazol-2-yl)-6-hydroxyhexyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 91178920 |
| Molecular Formula | C21H33N5O3S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | ethyl 6-[4-[5-amino-6-(4,5-dihydro-1,3-thiazol-2-yl)-6-hydroxyhexyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CCN(CCCCC(N)C(O)C3=NCCS3)CC2)nc1 |
| InChI | InChI=1S/C21H33N5O3S/c1-2-29-21(28)16-6-7-18(24-15-16)26-12-10-25(11-13-26)9-4-3-5-17(22)19(27)20-23-8-14-30-20/h6-7,15,17,19,27H,2-5,8-14,22H2,1H3 |
| InChIKey | ISIDWWXTLYMUQH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|