C21H31N5O3S — CID 23014424
2-amino-6-[4-(5-methoxy-1,3-benzoxazol-2-yl)piperazin-1-yl]-1-(1,3-thiazolidin-3-yl)hexan-1-one (PubChem CID 23014424) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-amino-6-[4-(5-methoxy-1,3-benzoxazol-2-yl)piperazin-1-yl]-1-(1,3-thiazolidin-3-yl)hexan-1-one.
| Compound Name | 2-amino-6-[4-(5-methoxy-1,3-benzoxazol-2-yl)piperazin-1-yl]-1-(1,3-thiazolidin-3-yl)hexan-1-one |
|---|---|
| PubChem CID | 23014424 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-amino-6-[4-(5-methoxy-1,3-benzoxazol-2-yl)piperazin-1-yl]-1-(1,3-thiazolidin-3-yl)hexan-1-one |
| SMILES | COc1ccc2oc(N3CCN(CCCCC(N)C(=O)N4CCSC4)CC3)nc2c1 |
| InChI | InChI=1S/C21H31N5O3S/c1-28-16-5-6-19-18(14-16)23-21(29-19)25-10-8-24(9-11-25)7-3-2-4-17(22)20(27)26-12-13-30-15-26/h5-6,14,17H,2-4,7-13,15,22H2,1H3 |
| InChIKey | QIFANAGFLXVHQB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|