C14H18ClN3O2 — CID 171335686
5-chloro-2-[4-(2-methoxyethyl)piperazin-1-yl]-1,3-benzoxazole (PubChem CID 171335686) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-2-[4-(2-methoxyethyl)piperazin-1-yl]-1,3-benzoxazole.
| Compound Name | 5-chloro-2-[4-(2-methoxyethyl)piperazin-1-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 171335686 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-chloro-2-[4-(2-methoxyethyl)piperazin-1-yl]-1,3-benzoxazole |
| SMILES | COCCN1CCN(c2nc3cc(Cl)ccc3o2)CC1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-19-9-8-17-4-6-18(7-5-17)14-16-12-10-11(15)2-3-13(12)20-14/h2-3,10H,4-9H2,1H3 |
| InChIKey | LCPCILAEIUTHCV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |