C21H23ClN4O4 — CID 167081505
N-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-4-carboxamide (PubChem CID 167081505) has the molecular formula C21H23ClN4O4 and a molecular weight of 430.89 g/mol. Its IUPAC name is N-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-4-carboxamide.
| Compound Name | N-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167081505 |
| Molecular Formula | C21H23ClN4O4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[1-(5-chloro-1,3-benzoxazol-2-yl)piperidin-4-yl]-2-(2-methoxyethoxy)pyridine-4-carboxamide |
| SMILES | COCCOc1cc(C(=O)NC2CCN(c3nc4cc(Cl)ccc4o3)CC2)ccn1 |
| InChI | InChI=1S/C21H23ClN4O4/c1-28-10-11-29-19-12-14(4-7-23-19)20(27)24-16-5-8-26(9-6-16)21-25-17-13-15(22)2-3-18(17)30-21/h2-4,7,12-13,16H,5-6,8-11H2,1H3,(H,24,27) |
| InChIKey | JGJCMMZFFMYDGG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|