C6H12N2OS — CID 59007232
(2S)-2-amino-1-(1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 59007232) has the molecular formula C6H12N2OS and a molecular weight of 160.24 g/mol. Its IUPAC name is (2S)-2-amino-1-(1,3-thiazolidin-3-yl)propan-1-one.
| Compound Name | (2S)-2-amino-1-(1,3-thiazolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 59007232 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2S)-2-amino-1-(1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | C[C@H](N)C(=O)N1CCSC1 |
| InChI | InChI=1S/C6H12N2OS/c1-5(7)6(9)8-2-3-10-4-8/h5H,2-4,7H2,1H3/t5-/m0/s1 |
| InChIKey | WVHJAZLSNVLXQS-YFKPBYRVSA-N |
| XLogP | -0.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |