C10H17NO5S — CID 82900985
4-[2-(2-methoxyethoxy)acetyl]thiomorpholine-3-carboxylic acid (PubChem CID 82900985) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)acetyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[2-(2-methoxyethoxy)acetyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82900985 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)acetyl]thiomorpholine-3-carboxylic acid |
| SMILES | COCCOCC(=O)N1CCSCC1C(=O)O |
| InChI | InChI=1S/C10H17NO5S/c1-15-3-4-16-6-9(12)11-2-5-17-7-8(11)10(13)14/h8H,2-7H2,1H3,(H,13,14) |
| InChIKey | QHIQPHDWQLZZCB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|