C12H22N2O5S2 — CID 66376225
(2S)-2-[(3-ethylsulfonylthiomorpholine-4-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 66376225) has the molecular formula C12H22N2O5S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2S)-2-[(3-ethylsulfonylthiomorpholine-4-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(3-ethylsulfonylthiomorpholine-4-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66376225 |
| Molecular Formula | C12H22N2O5S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (2S)-2-[(3-ethylsulfonylthiomorpholine-4-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C12H22N2O5S2/c1-4-21(18,19)9-7-20-6-5-14(9)12(17)13-10(8(2)3)11(15)16/h8-10H,4-7H2,1-3H3,(H,13,17)(H,15,16)/t9?,10-/m0/s1 |
| InChIKey | UAEMXEBKNMXPMY-AXDSSHIGSA-N |
| XLogP | 0.61 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |