C14H26N2O3S — CID 66443592
2-[4-[3-(aminomethyl)-5-methylhexanoyl]thiomorpholin-3-yl]acetic acid (PubChem CID 66443592) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[4-[3-(aminomethyl)-5-methylhexanoyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[3-(aminomethyl)-5-methylhexanoyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 66443592 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-[4-[3-(aminomethyl)-5-methylhexanoyl]thiomorpholin-3-yl]acetic acid |
| SMILES | CC(C)CC(CN)CC(=O)N1CCSCC1CC(=O)O |
| InChI | InChI=1S/C14H26N2O3S/c1-10(2)5-11(8-15)6-13(17)16-3-4-20-9-12(16)7-14(18)19/h10-12H,3-9,15H2,1-2H3,(H,18,19) |
| InChIKey | IJGYONFASXNLHY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |