C20H28O3Si — CID 162455396
trans-ethyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-trimethylsilylethynyl)cyclohexane-1-carboxylate (PubChem CID 162455396) has the molecular formula C20H28O3Si and a molecular weight of 344.53 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-trimethylsilylethynyl)cyclohexane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-trimethylsilylethynyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 162455396 |
| Molecular Formula | C20H28O3Si |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | trans-ethyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-trimethylsilylethynyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC(O)(C#C[Si](C)(C)C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H28O3Si/c1-5-23-19(21)17-11-12-20(22,13-14-24(2,3)4)15-18(17)16-9-7-6-8-10-16/h6-10,17-18,22H,5,11-12,15H2,1-4H3/t17-,18+,20?/m1/s1 |
| InChIKey | UZNDJVLLMWCFRQ-ZOVQDZKKSA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|