About 5-chloropentanenitrile;2-phenylpiperidine
5-chloropentanenitrile;2-phenylpiperidine (PubChem CID 161132642) has the molecular formula C16H23ClN2
and a molecular weight of 278.83 g/mol. Its IUPAC name is 5-chloropentanenitrile;2-phenylpiperidine.
Molecular Properties
| Compound Name | 5-chloropentanenitrile;2-phenylpiperidine |
| PubChem CID | 161132642 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 5-chloropentanenitrile;2-phenylpiperidine |
| SMILES | N#CCCCCCl.c1ccc(C2CCCCN2)cc1 |
| InChI | InChI=1S/C11H15N.C5H8ClN/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;6-4-2-1-3-5-7/h1-3,6-7,11-12H,4-5,8-9H2;1-4H2 |
| InChIKey | UMJWEAOLSBHCJJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloropentanenitrile;2-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloropentanenitrile;2-phenylpiperidine?
The IUPAC name of 5-chloropentanenitrile;2-phenylpiperidine (CID 161132642) is 5-chloropentanenitrile;2-phenylpiperidine.
What is the SMILES notation for 5-chloropentanenitrile;2-phenylpiperidine?
The canonical SMILES for 5-chloropentanenitrile;2-phenylpiperidine is N#CCCCCCl.c1ccc(C2CCCCN2)cc1.
What is the InChIKey of 5-chloropentanenitrile;2-phenylpiperidine?
The InChIKey is UMJWEAOLSBHCJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C5H8ClN/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;6-4-2-1-3-5-7/h1-3,6-7,11-12H,4-5,8-9H2;1-4H2.
What are the key properties of 5-chloropentanenitrile;2-phenylpiperidine?
5-chloropentanenitrile;2-phenylpiperidine has a molecular weight of 278.83 g/mol, XLogP of 4.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloropentanenitrile;2-phenylpiperidine is sourced from PubChem (CID 161132642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).