C10H13N3O4 — CID 171194223
3-nitro-5-[(2R)-piperazin-2-yl]benzene-1,2-diol (PubChem CID 171194223) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-nitro-5-[(2R)-piperazin-2-yl]benzene-1,2-diol.
| Compound Name | 3-nitro-5-[(2R)-piperazin-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 171194223 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-nitro-5-[(2R)-piperazin-2-yl]benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc([C@@H]2CNCCN2)cc(O)c1O |
| InChI | InChI=1S/C10H13N3O4/c14-9-4-6(7-5-11-1-2-12-7)3-8(10(9)15)13(16)17/h3-4,7,11-12,14-15H,1-2,5H2/t7-/m0/s1 |
| InChIKey | DFTYUEBUTRIRKJ-ZETCQYMHSA-N |
| XLogP | 0.24 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|