C10H13ClN2O4 — CID 171195837
3-nitro-5-[(2R)-pyrrolidin-2-yl]benzene-1,2-diol;hydrochloride (PubChem CID 171195837) has the molecular formula C10H13ClN2O4 and a molecular weight of 260.68 g/mol. Its IUPAC name is 3-nitro-5-[(2R)-pyrrolidin-2-yl]benzene-1,2-diol;hydrochloride.
| Compound Name | 3-nitro-5-[(2R)-pyrrolidin-2-yl]benzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 171195837 |
| Molecular Formula | C10H13ClN2O4 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3-nitro-5-[(2R)-pyrrolidin-2-yl]benzene-1,2-diol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc([C@H]2CCCN2)cc(O)c1O |
| InChI | InChI=1S/C10H12N2O4.ClH/c13-9-5-6(7-2-1-3-11-7)4-8(10(9)14)12(15)16;/h4-5,7,11,13-14H,1-3H2;1H/t7-;/m1./s1 |
| InChIKey | NCQIQCZKSCZVQV-OGFXRTJISA-N |
| XLogP | 1.85 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|