C11H13N3O3S — CID 43708496
N-(2-methyl-3-nitrophenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 43708496) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 43708496 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1c(NC(=O)C2CSCN2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O3S/c1-7-8(3-2-4-10(7)14(16)17)13-11(15)9-5-18-6-12-9/h2-4,9,12H,5-6H2,1H3,(H,13,15) |
| InChIKey | OSIRHZMWTFWQIU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|