C15H21BrN2O2 — CID 104814801
2-bromo-N-(4,4-dimethylcyclohexyl)-4-methyl-5-nitroaniline (PubChem CID 104814801) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 2-bromo-N-(4,4-dimethylcyclohexyl)-4-methyl-5-nitroaniline.
| Compound Name | 2-bromo-N-(4,4-dimethylcyclohexyl)-4-methyl-5-nitroaniline |
|---|---|
| PubChem CID | 104814801 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-bromo-N-(4,4-dimethylcyclohexyl)-4-methyl-5-nitroaniline |
| SMILES | Cc1cc(Br)c(NC2CCC(C)(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21BrN2O2/c1-10-8-12(16)13(9-14(10)18(19)20)17-11-4-6-15(2,3)7-5-11/h8-9,11,17H,4-7H2,1-3H3 |
| InChIKey | YBKFPJGACCEXSI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|