C15H21BrN2O2 — CID 65083383
N-(2-bromo-4-nitrophenyl)-4,4-dimethylcycloheptan-1-amine (PubChem CID 65083383) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-4,4-dimethylcycloheptan-1-amine.
| Compound Name | N-(2-bromo-4-nitrophenyl)-4,4-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 65083383 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-4,4-dimethylcycloheptan-1-amine |
| SMILES | CC1(C)CCCC(Nc2ccc([N+](=O)[O-])cc2Br)CC1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-15(2)8-3-4-11(7-9-15)17-14-6-5-12(18(19)20)10-13(14)16/h5-6,10-11,17H,3-4,7-9H2,1-2H3 |
| InChIKey | SZDFVKFLYPFJIT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|