C13H18BrN3O2 — CID 104814980
1-N-(2-bromo-4-methyl-5-nitrophenyl)cyclohexane-1,3-diamine (PubChem CID 104814980) has the molecular formula C13H18BrN3O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 1-N-(2-bromo-4-methyl-5-nitrophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(2-bromo-4-methyl-5-nitrophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 104814980 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 1-N-(2-bromo-4-methyl-5-nitrophenyl)cyclohexane-1,3-diamine |
| SMILES | Cc1cc(Br)c(NC2CCCC(N)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18BrN3O2/c1-8-5-11(14)12(7-13(8)17(18)19)16-10-4-2-3-9(15)6-10/h5,7,9-10,16H,2-4,6,15H2,1H3 |
| InChIKey | VXEPEAZAMSRRKC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|