C14H18BrF2N — CID 107609541
4-bromo-N-(3,3-dimethylcyclohexyl)-2,5-difluoroaniline (PubChem CID 107609541) has the molecular formula C14H18BrF2N and a molecular weight of 318.21 g/mol. Its IUPAC name is 4-bromo-N-(3,3-dimethylcyclohexyl)-2,5-difluoroaniline.
| Compound Name | 4-bromo-N-(3,3-dimethylcyclohexyl)-2,5-difluoroaniline |
|---|---|
| PubChem CID | 107609541 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-bromo-N-(3,3-dimethylcyclohexyl)-2,5-difluoroaniline |
| SMILES | CC1(C)CCCC(Nc2cc(F)c(Br)cc2F)C1 |
| InChI | InChI=1S/C14H18BrF2N/c1-14(2)5-3-4-9(8-14)18-13-7-11(16)10(15)6-12(13)17/h6-7,9,18H,3-5,8H2,1-2H3 |
| InChIKey | SNFNQHNGQJKERK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|