C12H15N3S2 — CID 103704155
N-(3-methylsulfanylcyclopentyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103704155) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is N-(3-methylsulfanylcyclopentyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-methylsulfanylcyclopentyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103704155 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(3-methylsulfanylcyclopentyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CSC1CCC(Nc2ncnc3sccc23)C1 |
| InChI | InChI=1S/C12H15N3S2/c1-16-9-3-2-8(6-9)15-11-10-4-5-17-12(10)14-7-13-11/h4-5,7-9H,2-3,6H2,1H3,(H,13,14,15) |
| InChIKey | KDTPWKRLVDHOSC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |