C13H16F3N3OS — CID 103150246
N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 103150246) has the molecular formula C13H16F3N3OS and a molecular weight of 319.35 g/mol. Its IUPAC name is N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 103150246 |
| Molecular Formula | C13H16F3N3OS |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-propyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCNc1nc(CCOCC(F)(F)F)nc2sccc12 |
| InChI | InChI=1S/C13H16F3N3OS/c1-2-5-17-11-9-4-7-21-12(9)19-10(18-11)3-6-20-8-13(14,15)16/h4,7H,2-3,5-6,8H2,1H3,(H,17,18,19) |
| InChIKey | PQMNJGSAAPLZIL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|