C12H14BrF4NO — CID 107591892
5-bromo-4-fluoro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline (PubChem CID 107591892) has the molecular formula C12H14BrF4NO and a molecular weight of 344.15 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline.
| Compound Name | 5-bromo-4-fluoro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline |
|---|---|
| PubChem CID | 107591892 |
| Molecular Formula | C12H14BrF4NO |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 5-bromo-4-fluoro-2-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]aniline |
| SMILES | Cc1cc(F)c(Br)cc1NCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H14BrF4NO/c1-8-5-10(14)9(13)6-11(8)18-3-2-4-19-7-12(15,16)17/h5-6,18H,2-4,7H2,1H3 |
| InChIKey | XKJAJHJTFHVWNQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|