C21H26ClN5OS — CID 174385739
N-[4-[[3-chloro-4-[4-iminopentan-2-yl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide (PubChem CID 174385739) has the molecular formula C21H26ClN5OS and a molecular weight of 431.99 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-[4-iminopentan-2-yl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[[3-chloro-4-[4-iminopentan-2-yl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 174385739 |
| Molecular Formula | C21H26ClN5OS |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[4-[[3-chloro-4-[4-iminopentan-2-yl(methyl)amino]phenyl]carbamothioylamino]phenyl]acetamide |
| SMILES | [H]/N=C(\C)CC(C)N(C)c1ccc(NC(=S)Nc2ccc(NC(C)=O)cc2)cc1Cl |
| InChI | InChI=1S/C21H26ClN5OS/c1-13(23)11-14(2)27(4)20-10-9-18(12-19(20)22)26-21(29)25-17-7-5-16(6-8-17)24-15(3)28/h5-10,12,14,23H,11H2,1-4H3,(H,24,28)(H2,25,26,29)/b23-13+ |
| InChIKey | DOGDXDIGMXPSMY-YDZHTSKRSA-N |
| XLogP | 5.36 |
| TPSA | 80.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|