C16H15Cl2N3O2S — CID 15954944
N-[4-[(3,5-dichloro-4-hydroxy-2-methylphenyl)carbamothioylamino]phenyl]acetamide (PubChem CID 15954944) has the molecular formula C16H15Cl2N3O2S and a molecular weight of 384.29 g/mol. Its IUPAC name is N-[4-[(3,5-dichloro-4-hydroxy-2-methylphenyl)carbamothioylamino]phenyl]acetamide.
| Compound Name | N-[4-[(3,5-dichloro-4-hydroxy-2-methylphenyl)carbamothioylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 15954944 |
| Molecular Formula | C16H15Cl2N3O2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | N-[4-[(3,5-dichloro-4-hydroxy-2-methylphenyl)carbamothioylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=S)Nc2cc(Cl)c(O)c(Cl)c2C)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O2S/c1-8-13(7-12(17)15(23)14(8)18)21-16(24)20-11-5-3-10(4-6-11)19-9(2)22/h3-7,23H,1-2H3,(H,19,22)(H2,20,21,24) |
| InChIKey | OXENGAVDZYEAEE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|