C21H25ClN2O4S — CID 84553596
tert-butyl N-[2-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]sulfanylethyl]carbamate (PubChem CID 84553596) has the molecular formula C21H25ClN2O4S and a molecular weight of 436.96 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84553596 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | tert-butyl N-[2-[2-(5-chloro-2-phenoxyanilino)-2-oxoethyl]sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCC(=O)Nc1cc(Cl)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C21H25ClN2O4S/c1-21(2,3)28-20(26)23-11-12-29-14-19(25)24-17-13-15(22)9-10-18(17)27-16-7-5-4-6-8-16/h4-10,13H,11-12,14H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | JWWHBGLKSHGPIG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|