C21H28N2O4S — CID 22948513
2-benzylsulfonylethyl N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22948513) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 2-benzylsulfonylethyl N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | 2-benzylsulfonylethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22948513 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-benzylsulfonylethyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OCCS(=O)(=O)Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H28N2O4S/c1-4-23(5-2)19-11-12-20(17(3)15-19)22-21(24)27-13-14-28(25,26)16-18-9-7-6-8-10-18/h6-12,15H,4-5,13-14,16H2,1-3H3,(H,22,24) |
| InChIKey | UZWWCLLHRZXAIG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|