C24H35N5O2 — CID 142102341
[3-(4-amino-N-ethylanilino)-3-methyliminopropyl] N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 142102341) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is [3-(4-amino-N-ethylanilino)-3-methyliminopropyl] N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | [3-(4-amino-N-ethylanilino)-3-methyliminopropyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 142102341 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | [3-(4-amino-N-ethylanilino)-3-methyliminopropyl] N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OCC/C(=N\C)N(CC)c2ccc(N)cc2)c(C)c1 |
| InChI | InChI=1S/C24H35N5O2/c1-6-28(7-2)21-13-14-22(18(4)17-21)27-24(30)31-16-15-23(26-5)29(8-3)20-11-9-19(25)10-12-20/h9-14,17H,6-8,15-16,25H2,1-5H3,(H,27,30)/b26-23+ |
| InChIKey | VTFYSAGHLCFWAL-WNAAXNPUSA-N |
| XLogP | 4.92 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|