C25H35N3O8S — CID 22095153
[4-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)phenyl]methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate (PubChem CID 22095153) has the molecular formula C25H35N3O8S and a molecular weight of 537.64 g/mol. Its IUPAC name is [4-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)phenyl]methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate.
| Compound Name | [4-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)phenyl]methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22095153 |
| Molecular Formula | C25H35N3O8S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | [4-(1,3-dioxolan-2-yl)-3-(methoxymethoxy)phenyl]methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(NC(=O)OCc2ccc(C3OCCO3)c(OCOC)c2)c(C)c1 |
| InChI | InChI=1S/C25H35N3O8S/c1-5-28(11-10-26-37(4,30)31)20-7-9-22(18(2)14-20)27-25(29)35-16-19-6-8-21(24-33-12-13-34-24)23(15-19)36-17-32-3/h6-9,14-15,24,26H,5,10-13,16-17H2,1-4H3,(H,27,29) |
| InChIKey | CKXDABFVPUILSU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|