C20H24N2O5 — CID 22095176
(4-formyl-3-hydroxyphenyl)methyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate (PubChem CID 22095176) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is (4-formyl-3-hydroxyphenyl)methyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate.
| Compound Name | (4-formyl-3-hydroxyphenyl)methyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22095176 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (4-formyl-3-hydroxyphenyl)methyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate |
| SMILES | CCN(CCO)c1ccc(NC(=O)OCc2ccc(C=O)c(O)c2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O5/c1-3-22(8-9-23)17-6-7-18(14(2)10-17)21-20(26)27-13-15-4-5-16(12-24)19(25)11-15/h4-7,10-12,23,25H,3,8-9,13H2,1-2H3,(H,21,26) |
| InChIKey | PUWHREQOWDITPV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|