About 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate
4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate (PubChem CID 159168735) has the molecular formula C11H21N3O3
and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate.
Molecular Properties
| Compound Name | 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate |
| PubChem CID | 159168735 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate |
| SMILES | CCN(CC)c1ccc(C=O)c(O)c1.NN.O |
| InChI | InChI=1S/C11H15NO2.H4N2.H2O/c1-3-12(4-2)10-6-5-9(8-13)11(14)7-10;1-2;/h5-8,14H,3-4H2,1-2H3;1-2H2;1H2 |
| InChIKey | KLKJNXPNXMTAGI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate?
The IUPAC name of 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate (CID 159168735) is 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate.
What is the SMILES notation for 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate?
The canonical SMILES for 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate is CCN(CC)c1ccc(C=O)c(O)c1.NN.O.
What is the InChIKey of 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate?
The InChIKey is KLKJNXPNXMTAGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.H4N2.H2O/c1-3-12(4-2)10-6-5-9(8-13)11(14)7-10;1-2;/h5-8,14H,3-4H2,1-2H3;1-2H2;1H2.
What are the key properties of 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate?
4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate has a molecular weight of 243.31 g/mol, XLogP of 0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)-2-hydroxybenzaldehyde;hydrazine;hydrate is sourced from PubChem (CID 159168735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).