C25H33N3O3S — CID 20734197
2-(6-butan-2-yl-1,3-benzothiazol-2-yl)ethyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate (PubChem CID 20734197) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 2-(6-butan-2-yl-1,3-benzothiazol-2-yl)ethyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate.
| Compound Name | 2-(6-butan-2-yl-1,3-benzothiazol-2-yl)ethyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 20734197 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-(6-butan-2-yl-1,3-benzothiazol-2-yl)ethyl N-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]carbamate |
| SMILES | CCC(C)c1ccc2nc(CCOC(=O)Nc3ccc(N(CC)CCO)cc3C)sc2c1 |
| InChI | InChI=1S/C25H33N3O3S/c1-5-17(3)19-7-9-22-23(16-19)32-24(26-22)11-14-31-25(30)27-21-10-8-20(15-18(21)4)28(6-2)12-13-29/h7-10,15-17,29H,5-6,11-14H2,1-4H3,(H,27,30) |
| InChIKey | FEOCEMRYHRUEGX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|