C22H24N2O3S — CID 73242246
3-(1,3-benzothiazol-2-yl)-4-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]but-3-enoic acid (PubChem CID 73242246) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]but-3-enoic acid.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 73242246 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-[4-[ethyl(2-hydroxyethyl)amino]-2-methylphenyl]but-3-enoic acid |
| SMILES | CCN(CCO)c1ccc(C=C(CC(=O)O)c2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C22H24N2O3S/c1-3-24(10-11-25)18-9-8-16(15(2)12-18)13-17(14-21(26)27)22-23-19-6-4-5-7-20(19)28-22/h4-9,12-13,25H,3,10-11,14H2,1-2H3,(H,26,27) |
| InChIKey | CSXNGPSATJGDAW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|