C18H25ClN4O5S — CID 59085227
2-(5-chloro-1,3-oxazol-2-yl)ethyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate (PubChem CID 59085227) has the molecular formula C18H25ClN4O5S and a molecular weight of 444.94 g/mol. Its IUPAC name is 2-(5-chloro-1,3-oxazol-2-yl)ethyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate.
| Compound Name | 2-(5-chloro-1,3-oxazol-2-yl)ethyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 59085227 |
| Molecular Formula | C18H25ClN4O5S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-(5-chloro-1,3-oxazol-2-yl)ethyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(NC(=O)OCCc2ncc(Cl)o2)c(C)c1 |
| InChI | InChI=1S/C18H25ClN4O5S/c1-4-23(9-8-21-29(3,25)26)14-5-6-15(13(2)11-14)22-18(24)27-10-7-17-20-12-16(19)28-17/h5-6,11-12,21H,4,7-10H2,1-3H3,(H,22,24) |
| InChIKey | PXJXTQASZBMDIM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|