C23H31N3O8S — CID 22095133
(2-formyl-3-hydroxy-4,5-dimethoxyphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate (PubChem CID 22095133) has the molecular formula C23H31N3O8S and a molecular weight of 509.58 g/mol. Its IUPAC name is (2-formyl-3-hydroxy-4,5-dimethoxyphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate.
| Compound Name | (2-formyl-3-hydroxy-4,5-dimethoxyphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22095133 |
| Molecular Formula | C23H31N3O8S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (2-formyl-3-hydroxy-4,5-dimethoxyphenyl)methyl N-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]carbamate |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(NC(=O)OCc2cc(OC)c(OC)c(O)c2C=O)c(C)c1 |
| InChI | InChI=1S/C23H31N3O8S/c1-6-26(10-9-24-35(5,30)31)17-7-8-19(15(2)11-17)25-23(29)34-14-16-12-20(32-3)22(33-4)21(28)18(16)13-27/h7-8,11-13,24,28H,6,9-10,14H2,1-5H3,(H,25,29) |
| InChIKey | NNSKKXORZAZKGI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|