C24H31N3O5 — CID 22889617
[4-(1-cyclopropylethoxy)-3-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 22889617) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is [4-(1-cyclopropylethoxy)-3-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | [4-(1-cyclopropylethoxy)-3-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 22889617 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [4-(1-cyclopropylethoxy)-3-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OCc2ccc(OC(C)C3CC3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C24H31N3O5/c1-5-26(6-2)20-10-11-21(16(3)13-20)25-24(28)31-15-18-7-12-23(22(14-18)27(29)30)32-17(4)19-8-9-19/h7,10-14,17,19H,5-6,8-9,15H2,1-4H3,(H,25,28) |
| InChIKey | PWXWFRYWWQZXLJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|