C32H32N4O5 — CID 23550595
[2-(carbazol-9-ylmethoxy)-5-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate (PubChem CID 23550595) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is [2-(carbazol-9-ylmethoxy)-5-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate.
| Compound Name | [2-(carbazol-9-ylmethoxy)-5-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 23550595 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [2-(carbazol-9-ylmethoxy)-5-nitrophenyl]methyl N-[4-(diethylamino)-2-methylphenyl]carbamate |
| SMILES | CCN(CC)c1ccc(NC(=O)OCc2cc([N+](=O)[O-])ccc2OCn2c3ccccc3c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C32H32N4O5/c1-4-34(5-2)24-14-16-28(22(3)18-24)33-32(37)40-20-23-19-25(36(38)39)15-17-31(23)41-21-35-29-12-8-6-10-26(29)27-11-7-9-13-30(27)35/h6-19H,4-5,20-21H2,1-3H3,(H,33,37) |
| InChIKey | CPSWHELTEKACCO-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|