C23H31N3O3 — CID 108955868
N-[4-(diethylamino)-2-methylphenyl]-N'-(2-propan-2-yloxyphenyl)propanediamide (PubChem CID 108955868) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N'-(2-propan-2-yloxyphenyl)propanediamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(2-propan-2-yloxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108955868 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(2-propan-2-yloxyphenyl)propanediamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CC(=O)Nc2ccccc2OC(C)C)c(C)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-6-26(7-2)18-12-13-19(17(5)14-18)24-22(27)15-23(28)25-20-10-8-9-11-21(20)29-16(3)4/h8-14,16H,6-7,15H2,1-5H3,(H,24,27)(H,25,28) |
| InChIKey | KODUFHZVAIPQNI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|