C14H12Br2N4O2 — CID 122650846
4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylaniline (PubChem CID 122650846) has the molecular formula C14H12Br2N4O2 and a molecular weight of 428.08 g/mol. Its IUPAC name is 4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylaniline.
| Compound Name | 4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylaniline |
|---|---|
| PubChem CID | 122650846 |
| Molecular Formula | C14H12Br2N4O2 |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 425.93 |
| IUPAC Name | 4-[(2,6-dibromo-4-nitrophenyl)diazenyl]-N-ethylaniline |
| SMILES | CCNc1ccc(/N=N/c2c(Br)cc([N+](=O)[O-])cc2Br)cc1 |
| InChI | InChI=1S/C14H12Br2N4O2/c1-2-17-9-3-5-10(6-4-9)18-19-14-12(15)7-11(20(21)22)8-13(14)16/h3-8,17H,2H2,1H3/b19-18+ |
| InChIKey | IUYFGOUORPLWAM-VHEBQXMUSA-N |
| XLogP | 5.97 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|