C42H49N9O7 — CID 11803412
2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[(3R,4R)-3,4-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]pyrrolidin-1-yl]-4-oxobutanoate (PubChem CID 11803412) has the molecular formula C42H49N9O7 and a molecular weight of 791.91 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[(3R,4R)-3,4-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]pyrrolidin-1-yl]-4-oxobutanoate.
| Compound Name | 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[(3R,4R)-3,4-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]pyrrolidin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 11803412 |
| Molecular Formula | C42H49N9O7 |
| Molecular Weight | 791.91 g/mol |
| Exact Mass | 791.38 |
| IUPAC Name | 2-[N-ethyl-4-[(4-nitrophenyl)diazenyl]anilino]ethyl 4-[(3R,4R)-3,4-bis[[(2S)-2-amino-3-phenylpropanoyl]amino]pyrrolidin-1-yl]-4-oxobutanoate |
| SMILES | CCN(CCOC(=O)CCC(=O)N1C[C@@H](NC(=O)[C@@H](N)Cc2ccccc2)[C@H](NC(=O)[C@@H](N)Cc2ccccc2)C1)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C42H49N9O7/c1-2-49(33-17-13-31(14-18-33)47-48-32-15-19-34(20-16-32)51(56)57)23-24-58-40(53)22-21-39(52)50-27-37(45-41(54)35(43)25-29-9-5-3-6-10-29)38(28-50)46-42(55)36(44)26-30-11-7-4-8-12-30/h3-20,35-38H,2,21-28,43-44H2,1H3,(H,45,54)(H,46,55)/b48-47+/t35-,36-,37+,38+/m0/s1 |
| InChIKey | DARYFTSWHSUZMB-GNTNVFSWSA-N |
| XLogP | 4.11 |
| TPSA | 227.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|