C32H41N3O9 — CID 89258792
4-O-[(3aR,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-[2-(N-ethyl-4-phenyldiazenylanilino)ethyl] butanedioate (PubChem CID 89258792) has the molecular formula C32H41N3O9 and a molecular weight of 611.69 g/mol. Its IUPAC name is 4-O-[(3aR,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-[2-(N-ethyl-4-phenyldiazenylanilino)ethyl] butanedioate.
| Compound Name | 4-O-[(3aR,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-[2-(N-ethyl-4-phenyldiazenylanilino)ethyl] butanedioate |
|---|---|
| PubChem CID | 89258792 |
| Molecular Formula | C32H41N3O9 |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | 4-O-[(3aR,5R,6S,6aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 1-O-[2-(N-ethyl-4-phenyldiazenylanilino)ethyl] butanedioate |
| SMILES | CCN(CCOC(=O)CCC(=O)O[C@@H]1[C@@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1)c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C32H41N3O9/c1-6-35(23-14-12-22(13-15-23)34-33-21-10-8-7-9-11-21)18-19-38-25(36)16-17-26(37)40-28-27(24-20-39-31(2,3)42-24)41-30-29(28)43-32(4,5)44-30/h7-15,24,27-30H,6,16-20H2,1-5H3/b34-33+/t24-,27-,28+,29+,30-/m1/s1 |
| InChIKey | QSYSFIOXXSZPBY-RRTJCPLSSA-N |
| XLogP | 5.19 |
| TPSA | 126.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|