C22H33NO6 — CID 18805096
N-[3-[[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propyl]-N-methylaniline (PubChem CID 18805096) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[3-[[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propyl]-N-methylaniline.
| Compound Name | N-[3-[[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propyl]-N-methylaniline |
|---|---|
| PubChem CID | 18805096 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[3-[[(3aR,5R,6S,6aR)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]propyl]-N-methylaniline |
| SMILES | CN(CCCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C1COC(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C22H33NO6/c1-21(2)25-14-16(27-21)17-18(19-20(26-17)29-22(3,4)28-19)24-13-9-12-23(5)15-10-7-6-8-11-15/h6-8,10-11,16-20H,9,12-14H2,1-5H3/t16?,17-,18+,19-,20-/m1/s1 |
| InChIKey | XUECFHPMYULZGF-DGDSNLKDSA-N |
| XLogP | 2.93 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|