C18H30O7 — CID 89386084
6-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]hexanal (PubChem CID 89386084) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is 6-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]hexanal.
| Compound Name | 6-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]hexanal |
|---|---|
| PubChem CID | 89386084 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 6-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]hexanal |
| SMILES | CC1(C)OCC(C2OC3OC(C)(C)OC3C2OCCCCCC=O)O1 |
| InChI | InChI=1S/C18H30O7/c1-17(2)21-11-12(23-17)13-14(20-10-8-6-5-7-9-19)15-16(22-13)25-18(3,4)24-15/h9,12-16H,5-8,10-11H2,1-4H3 |
| InChIKey | QWGOWMBIHLSSPC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|