C22H41O6P — CID 101358069
2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethyl-dibutylphosphane (PubChem CID 101358069) has the molecular formula C22H41O6P and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethyl-dibutylphosphane.
| Compound Name | 2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethyl-dibutylphosphane |
|---|---|
| PubChem CID | 101358069 |
| Molecular Formula | C22H41O6P |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 2-[[(3aR,5R,6S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]oxy]ethyl-dibutylphosphane |
| SMILES | CCCCP(CCCC)CCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H41O6P/c1-7-9-12-29(13-10-8-2)14-11-23-18-17(16-15-24-21(3,4)26-16)25-20-19(18)27-22(5,6)28-20/h16-20H,7-15H2,1-6H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | OAIJXSULSLRBTO-OUUBHVDSSA-N |
| XLogP | 4.48 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|