C18H21N3O4 — CID 165036826
3-[3-methyl-4-[(4-nitrophenyl)diazenyl]phenyl]pentane-1,5-diol (PubChem CID 165036826) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[3-methyl-4-[(4-nitrophenyl)diazenyl]phenyl]pentane-1,5-diol.
| Compound Name | 3-[3-methyl-4-[(4-nitrophenyl)diazenyl]phenyl]pentane-1,5-diol |
|---|---|
| PubChem CID | 165036826 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 3-[3-methyl-4-[(4-nitrophenyl)diazenyl]phenyl]pentane-1,5-diol |
| SMILES | Cc1cc(C(CCO)CCO)ccc1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-13-12-15(14(8-10-22)9-11-23)2-7-18(13)20-19-16-3-5-17(6-4-16)21(24)25/h2-7,12,14,22-23H,8-11H2,1H3/b20-19+ |
| InChIKey | ATDNAQQSJIEEQB-FMQUCBEESA-N |
| XLogP | 4.17 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|