C14H12N5O2+ — CID 59112489
2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]benzenediazonium (PubChem CID 59112489) has the molecular formula C14H12N5O2+ and a molecular weight of 282.28 g/mol. Its IUPAC name is 2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]benzenediazonium.
| Compound Name | 2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]benzenediazonium |
|---|---|
| PubChem CID | 59112489 |
| Molecular Formula | C14H12N5O2+ |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]benzenediazonium |
| SMILES | Cc1cc([N+]#N)c(C)cc1/N=N/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12N5O2/c1-9-8-14(10(2)7-13(9)16-15)18-17-11-3-5-12(6-4-11)19(20)21/h3-8H,1-2H3/q+1/b18-17+ |
| InChIKey | NWDHBJONRYSTMF-ISLYRVAYSA-N |
| XLogP | 5.11 |
| TPSA | 96.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|